CAS 210108-51-3 is the registry number for 6-Bromo-4-chloro-N,N-dimethylquinolin-2-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-bromo-4-chloro-N,N-dimethylquinolin-2-amine (CAS 210108-51-3) is a chemical compound with the molecular formula C11H10BrClN2 and a molecular weight of 285.57 g/mol. IUPAC name: 6-bromo-4-chloro-N,N-dimethylquinolin-2-amine. InChIKey: GKBWUEKPFBOLCF-UHFFFAOYSA-N.
| Molecular formula | C11H10BrClN2 |
|---|---|
| Molecular weight | 285.57 g/mol |
| IUPAC name | 6-bromo-4-chloro-N,N-dimethylquinolin-2-amine |
| InChIKey | GKBWUEKPFBOLCF-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC2=C(C=C(C=C2)Br)C(=C1)Cl |
Computed by PubChem (NCBI)