CAS 887592-14-5 is the registry number for 7-Bromo-4-chloro-2-isopropylquinazoline, 97%. Offered by: AmBeed. Available pack sizes: 5g.
7-bromo-4-chloro-2-propan-2-ylquinazoline (CAS 887592-14-5) is a chemical compound with the molecular formula C11H10BrClN2 and a molecular weight of 285.57 g/mol. IUPAC name: 7-bromo-4-chloro-2-propan-2-ylquinazoline. InChIKey: UKVPMUMFQNOIJG-UHFFFAOYSA-N.
| Molecular formula | C11H10BrClN2 |
|---|---|
| Molecular weight | 285.57 g/mol |
| IUPAC name | 7-bromo-4-chloro-2-propan-2-ylquinazoline |
| InChIKey | UKVPMUMFQNOIJG-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC2=C(C=CC(=C2)Br)C(=N1)Cl |
Computed by PubChem (NCBI)