CAS 210110-90-0 appears in our catalog under these names: Miglustat hydrochloride, 95%, Miglustat HCl, N-Butyldeoxynojirimycin Hydrochloride, >95% (HPLC), Miglustat hydrochloride/ 99.61% (existing batch purity), Miglustat hydrochloride. Offered by: Combi-blocks, Chemat Brand, TRC, TargetMol, GLPBio. Available pack sizes: 10mg, 25mg, 5mg, on request, 50mg, 1mg, 2mg, 100mg.
(2R,3R,4R,5S)-1-butyl-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride (CAS 210110-90-0) is a chemical compound with the molecular formula C10H22ClNO4 and a molecular weight of 255.74 g/mol. IUPAC name: (2R,3R,4R,5S)-1-butyl-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride. InChIKey: QPAFAUYWVZMWPR-ZSOUGHPYSA-N.
| Molecular formula | C10H22ClNO4 |
|---|---|
| Molecular weight | 255.74 g/mol |
| IUPAC name | (2R,3R,4R,5S)-1-butyl-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride |
| InChIKey | QPAFAUYWVZMWPR-ZSOUGHPYSA-N |
| SMILES | CCCCN1C[C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O.Cl |
Computed by PubChem (NCBI)