Products 2618724-70-0
CAS 2618724-70-0 appears in our catalog under these names: 2-(2-(2-Carboxyethoxy)ethoxy)-N,N,N-trimethylethan-1-aminium chloride, 95%, 2-(2-(2-carboxyethoxy)ethoxy)-N,N,N-trimethylethan-1-aminium chloride, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 1g, 5g.
2-[2-(2-carboxyethoxy)ethoxy]ethyl-trimethylazanium chloride (CAS 2618724-70-0) is a chemical compound with the molecular formula C10H22ClNO4 and a molecular weight of 255.74 g/mol. IUPAC name: 2-[2-(2-carboxyethoxy)ethoxy]ethyl-trimethylazanium chloride. InChIKey: FIFUELXKRDSSIH-UHFFFAOYSA-N.
| Molecular formula | C10H22ClNO4 |
|---|---|
| Molecular weight | 255.74 g/mol |
| IUPAC name | 2-[2-(2-carboxyethoxy)ethoxy]ethyl-trimethylazanium chloride |
| InChIKey | FIFUELXKRDSSIH-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CCOCCOCCC(=O)O.[Cl-] |
Computed by PubChem (NCBI)