CAS 210113-71-6 appears in our catalog under these names: 4'–(Bromomethyl)–2–chloro–1,1'–biphenyl, 4'-(Bromomethyl)-2-chloro-1,1'-biphenyl 90%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-(bromomethyl)-4-(2-chlorophenyl)benzene (CAS 210113-71-6) is a chemical compound with the molecular formula C13H10BrCl and a molecular weight of 281.57 g/mol. IUPAC name: 1-(bromomethyl)-4-(2-chlorophenyl)benzene. InChIKey: AKKKBAAKKXGEQY-UHFFFAOYSA-N.
| Molecular formula | C13H10BrCl |
|---|---|
| Molecular weight | 281.57 g/mol |
| IUPAC name | 1-(bromomethyl)-4-(2-chlorophenyl)benzene |
| InChIKey | AKKKBAAKKXGEQY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)CBr)Cl |
Computed by PubChem (NCBI)