CAS 82617-46-7 is the registry number for 3-(Bromomethyl)-2-chloro-1,1'-biphenyl, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(bromomethyl)-2-chloro-3-phenylbenzene (CAS 82617-46-7) is a chemical compound with the molecular formula C13H10BrCl and a molecular weight of 281.57 g/mol. IUPAC name: 1-(bromomethyl)-2-chloro-3-phenylbenzene. InChIKey: QNGGGASBGGPJGR-UHFFFAOYSA-N.
| Molecular formula | C13H10BrCl |
|---|---|
| Molecular weight | 281.57 g/mol |
| IUPAC name | 1-(bromomethyl)-2-chloro-3-phenylbenzene |
| InChIKey | QNGGGASBGGPJGR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC(=C2Cl)CBr |
Computed by PubChem (NCBI)