Products 21019-43-2

CAS 21019-43-2 is the registry number for (±)-cis-9,10-Epoxy-12(Z)-octadecenoic acid methyl ester. Offered by: TRC. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

Methyl 8-[(2R,3S)-3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoate (CAS 21019-43-2) is a chemical compound with the molecular formula C19H34O3 and a molecular weight of 310.5 g/mol. IUPAC name: methyl 8-[(2R,3S)-3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoate. InChIKey: JCJMEMDHUZYVMB-OPEQHFAOSA-N.

Identity
Molecular formulaC19H34O3
Molecular weight310.5 g/mol
IUPAC namemethyl 8-[(2R,3S)-3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoate
InChIKeyJCJMEMDHUZYVMB-OPEQHFAOSA-N
SMILESCCCCC/C=C\C[C@H]1[C@H](O1)CCCCCCCC(=O)OC

Computed by PubChem (NCBI)