Products 213738-77-3

CAS 213738-77-3 is the registry number for UCM710. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 25 mg.

Structural formula: {0} (CAS {1})

Oxiran-2-ylmethyl (Z)-hexadec-9-enoate (CAS 213738-77-3) is a chemical compound with the molecular formula C19H34O3 and a molecular weight of 310.5 g/mol. IUPAC name: oxiran-2-ylmethyl (Z)-hexadec-9-enoate. InChIKey: FWEHVPCBXKCYHE-FPLPWBNLSA-N.

Identity
Molecular formulaC19H34O3
Molecular weight310.5 g/mol
IUPAC nameoxiran-2-ylmethyl (Z)-hexadec-9-enoate
InChIKeyFWEHVPCBXKCYHE-FPLPWBNLSA-N
SMILESCCCCCC/C=C\CCCCCCCC(=O)OCC1CO1

Computed by PubChem (NCBI)