CAS 2101978-89-4 is the registry number for (R)-8-Methyl-2-phenyl-2,3-dihydrobenzo[b][1,4]thiazepin-4(5H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-8-methyl-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepin-4-one (CAS 2101978-89-4) is a chemical compound with the molecular formula C16H15NOS and a molecular weight of 269.4 g/mol. IUPAC name: (2R)-8-methyl-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepin-4-one. InChIKey: YBFPNHPZEBRRLY-CQSZACIVSA-N.
| Molecular formula | C16H15NOS |
|---|---|
| Molecular weight | 269.4 g/mol |
| IUPAC name | (2R)-8-methyl-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
| InChIKey | YBFPNHPZEBRRLY-CQSZACIVSA-N |
| SMILES | CC1=CC2=C(C=C1)NC(=O)C[C@@H](S2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)