Products 2757083-72-8
CAS 2757083-72-8 appears in our catalog under these names: (R)-2-(2-(Methylthio)phenyl)-4-phenyl-4,5-dihydrooxazole, 97%, 97%, (R)-2-(2-(Methylthio)phenyl)-4-phenyl-4,5-dihydrooxazole, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(4R)-2-(2-methylsulfanylphenyl)-4-phenyl-4,5-dihydro-1,3-oxazole (CAS 2757083-72-8) is a chemical compound with the molecular formula C16H15NOS and a molecular weight of 269.4 g/mol. IUPAC name: (4R)-2-(2-methylsulfanylphenyl)-4-phenyl-4,5-dihydro-1,3-oxazole. InChIKey: CWXLYGZJGRCNLT-AWEZNQCLSA-N.
| Molecular formula | C16H15NOS |
|---|---|
| Molecular weight | 269.4 g/mol |
| IUPAC name | (4R)-2-(2-methylsulfanylphenyl)-4-phenyl-4,5-dihydro-1,3-oxazole |
| InChIKey | CWXLYGZJGRCNLT-AWEZNQCLSA-N |
| SMILES | CSC1=CC=CC=C1C2=N[C@@H](CO2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)