Products 2102090-17-3
CAS 2102090-17-3 appears in our catalog under these names: 3-((Dimethylamino)methyl)-5-methylhexan-2-one oxalate, 95%, 3-[(dimethylamino)methyl]-5-methyl-hexan-2-one,oxalic acid, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 10g, 25g, 100g.
3-[(dimethylamino)methyl]-5-methylhexan-2-one;oxalic acid (CAS 2102090-17-3) is a chemical compound with the molecular formula C12H23NO5 and a molecular weight of 261.31 g/mol. IUPAC name: 3-[(dimethylamino)methyl]-5-methylhexan-2-one;oxalic acid. InChIKey: YGKBBKCXXBMFRQ-UHFFFAOYSA-N.
| Molecular formula | C12H23NO5 |
|---|---|
| Molecular weight | 261.31 g/mol |
| IUPAC name | 3-[(dimethylamino)methyl]-5-methylhexan-2-one;oxalic acid |
| InChIKey | YGKBBKCXXBMFRQ-UHFFFAOYSA-N |
| SMILES | CC(C)CC(CN(C)C)C(=O)C.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)