CAS 2102410-60-4 is the registry number for (3S,4S)–benzyl 4–(cyclopropylamino)–3–fluoropiperidine–1–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
Benzyl (3S,4S)-4-(cyclopropylamino)-3-fluoropiperidine-1-carboxylate (CAS 2102410-60-4) is a chemical compound with the molecular formula C16H21FN2O2 and a molecular weight of 292.35 g/mol. IUPAC name: benzyl (3S,4S)-4-(cyclopropylamino)-3-fluoropiperidine-1-carboxylate. InChIKey: MXXHIMMQMBVVGB-GJZGRUSLSA-N.
| Molecular formula | C16H21FN2O2 |
|---|---|
| Molecular weight | 292.35 g/mol |
| IUPAC name | benzyl (3S,4S)-4-(cyclopropylamino)-3-fluoropiperidine-1-carboxylate |
| InChIKey | MXXHIMMQMBVVGB-GJZGRUSLSA-N |
| SMILES | C1CN(C[C@@H]([C@H]1NC2CC2)F)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)