Products 942606-12-4
CAS 942606-12-4 is the registry number for JN403. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(1S)-1-(2-fluorophenyl)ethyl] N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]carbamate (CAS 942606-12-4) is a chemical compound with the molecular formula C16H21FN2O2 and a molecular weight of 292.35 g/mol. IUPAC name: [(1S)-1-(2-fluorophenyl)ethyl] N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]carbamate. InChIKey: HQYLURGLNKLOQJ-XHDPSFHLSA-N.
| Molecular formula | C16H21FN2O2 |
|---|---|
| Molecular weight | 292.35 g/mol |
| IUPAC name | [(1S)-1-(2-fluorophenyl)ethyl] N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]carbamate |
| InChIKey | HQYLURGLNKLOQJ-XHDPSFHLSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1F)OC(=O)N[C@@H]2CN3CCC2CC3 |
Computed by PubChem (NCBI)