CAS 2102410-71-7 is the registry number for TERT-BUTYL (CYCLOPROPYLCARBAMOYL) METHYLCARBAMATE, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Cyclopropylcarbamoyl N-tert-butyl-N-methylcarbamate (CAS 2102410-71-7) is a chemical compound with the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. IUPAC name: cyclopropylcarbamoyl N-tert-butyl-N-methylcarbamate. InChIKey: VNOPXKAPGYSALV-UHFFFAOYSA-N.
| Molecular formula | C10H18N2O3 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | cyclopropylcarbamoyl N-tert-butyl-N-methylcarbamate |
| InChIKey | VNOPXKAPGYSALV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N(C)C(=O)OC(=O)NC1CC1 |
Computed by PubChem (NCBI)