Products 2102412-77-9
CAS 2102412-77-9 appears in our catalog under these names: (6S)-4-Oxo-5-azaspiro[2.4]heptane-6-carboxylic acid, 95%, (S)-4-Oxo-5-azaspiro(2.4)heptane-6-carboxylic acid, 97%, (6S)–4–Oxo–5–azaspiro(2·4)heptane–6–carboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 5g, 1g, 250mg.
(6S)-4-oxo-5-azaspiro[2.4]heptane-6-carboxylic acid (CAS 2102412-77-9) is a chemical compound with the molecular formula C7H9NO3 and a molecular weight of 155.15 g/mol. IUPAC name: (6S)-4-oxo-5-azaspiro[2.4]heptane-6-carboxylic acid. InChIKey: LFYFIPUSMXSACI-BYPYZUCNSA-N.
| Molecular formula | C7H9NO3 |
|---|---|
| Molecular weight | 155.15 g/mol |
| IUPAC name | (6S)-4-oxo-5-azaspiro[2.4]heptane-6-carboxylic acid |
| InChIKey | LFYFIPUSMXSACI-BYPYZUCNSA-N |
| SMILES | C1CC12C[C@H](NC2=O)C(=O)O |
Computed by PubChem (NCBI)