CAS 2102502-49-6 is the registry number for 2-((1R,5S,6S)-3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl)acetonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(1R,5S)-3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl]acetonitrile (CAS 2102502-49-6) is a chemical compound with the molecular formula C14H16N2 and a molecular weight of 212.29 g/mol. IUPAC name: 2-[(1R,5S)-3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl]acetonitrile. InChIKey: KOKVEEYETYCXMM-AGUYFDCRSA-N.
| Molecular formula | C14H16N2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | 2-[(1R,5S)-3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl]acetonitrile |
| InChIKey | KOKVEEYETYCXMM-AGUYFDCRSA-N |
| SMILES | C1[C@@H]2[C@@H](C2CC#N)CN1CC3=CC=CC=C3 |
Computed by PubChem (NCBI)