CAS 2102664-68-4 is the registry number for Methyl 2-bromo-4-methoxybenzo[d]thiazole-6-carboxylate, 98%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 100mg.
Methyl 2-bromo-4-methoxy-1,3-benzothiazole-6-carboxylate (CAS 2102664-68-4) is a chemical compound with the molecular formula C10H8BrNO3S and a molecular weight of 302.15 g/mol. IUPAC name: methyl 2-bromo-4-methoxy-1,3-benzothiazole-6-carboxylate. InChIKey: YVEDWWBAPREOBF-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO3S |
|---|---|
| Molecular weight | 302.15 g/mol |
| IUPAC name | methyl 2-bromo-4-methoxy-1,3-benzothiazole-6-carboxylate |
| InChIKey | YVEDWWBAPREOBF-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=CC(=C1)C(=O)OC)SC(=N2)Br |
Computed by PubChem (NCBI)