CAS 423768-50-7 is the registry number for Ethyl 5-(5-bromo-2-thienyl)-3-isoxazolecarboxylate, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g, 5g.
Ethyl 5-(5-bromothiophen-2-yl)-1,2-oxazole-3-carboxylate (CAS 423768-50-7) is a chemical compound with the molecular formula C10H8BrNO3S and a molecular weight of 302.15 g/mol. IUPAC name: ethyl 5-(5-bromothiophen-2-yl)-1,2-oxazole-3-carboxylate. InChIKey: OIZZMDOBYXRSNQ-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO3S |
|---|---|
| Molecular weight | 302.15 g/mol |
| IUPAC name | ethyl 5-(5-bromothiophen-2-yl)-1,2-oxazole-3-carboxylate |
| InChIKey | OIZZMDOBYXRSNQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=C1)C2=CC=C(S2)Br |
Computed by PubChem (NCBI)