CAS 210286-72-9 is the registry number for 2,5,5,8,8-Pentamethyl-5,6,7,8-tetrahydro-1H-cyclopenta[b]naphthalene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,5,5,8,8-pentamethyl-6,7-dihydro-1H-cyclopenta[b]naphthalene (CAS 210286-72-9) is a chemical compound with the molecular formula C18H24 and a molecular weight of 240.4 g/mol. IUPAC name: 2,5,5,8,8-pentamethyl-6,7-dihydro-1H-cyclopenta[b]naphthalene. InChIKey: VKECIXZVHLGIJT-UHFFFAOYSA-N.
| Molecular formula | C18H24 |
|---|---|
| Molecular weight | 240.4 g/mol |
| IUPAC name | 2,5,5,8,8-pentamethyl-6,7-dihydro-1H-cyclopenta[b]naphthalene |
| InChIKey | VKECIXZVHLGIJT-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC3=C(C=C2C1)C(CCC3(C)C)(C)C |
Computed by PubChem (NCBI)