CAS 3905-64-4 appears in our catalog under these names: 2,6-Di-tert-butylnaphthalene, 98%, 2,6–Di–tert–butylnaphthalene, 2,6-Di-tert-butylnaphthalene, >98.0%(GC), 2,6-Di-tert-butylnaphthalene 97%, 2,6-Di-tert-butylnaphthalene, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 25g, 1g, 5g.
2,6-ditert-butylnaphthalene (CAS 3905-64-4) is a chemical compound with the molecular formula C18H24 and a molecular weight of 240.4 g/mol. IUPAC name: 2,6-ditert-butylnaphthalene. InChIKey: TZGXZNWUOXLMFL-UHFFFAOYSA-N.
| Molecular formula | C18H24 |
|---|---|
| Molecular weight | 240.4 g/mol |
| IUPAC name | 2,6-ditert-butylnaphthalene |
| InChIKey | TZGXZNWUOXLMFL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)C=C(C=C2)C(C)(C)C |
Computed by PubChem (NCBI)