CAS 2105380-44-5 appears in our catalog under these names: cis–4–(Azetidin–1–yl)–3–fluoropiperidine dihydrochloride, cis-4-(Azetidin-1-yl)-3-fluoropiperidine dihydrochloride, 97%, 97%. Offered by: GLPBio, Chemat. Available pack sizes: 50mg, 100mg.
(3S,4R)-4-(azetidin-1-yl)-3-fluoropiperidine;dihydrochloride (CAS 2105380-44-5) is a chemical compound with the molecular formula C8H17Cl2FN2 and a molecular weight of 231.14 g/mol. IUPAC name: (3S,4R)-4-(azetidin-1-yl)-3-fluoropiperidine;dihydrochloride. InChIKey: URIDQHGCHQFRFK-OXOJUWDDSA-N.
| Molecular formula | C8H17Cl2FN2 |
|---|---|
| Molecular weight | 231.14 g/mol |
| IUPAC name | (3S,4R)-4-(azetidin-1-yl)-3-fluoropiperidine;dihydrochloride |
| InChIKey | URIDQHGCHQFRFK-OXOJUWDDSA-N |
| SMILES | C1CN(C1)[C@@H]2CCNC[C@@H]2F.Cl.Cl |
Computed by PubChem (NCBI)