CAS 949495-06-1 is the registry number for N-(((3R,4S)-4-Fluoropyrrolidin-3-yl)methyl)cyclopropanamine dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[[(3R,4S)-4-fluoropyrrolidin-3-yl]methyl]cyclopropanamine;dihydrochloride (CAS 949495-06-1) is a chemical compound with the molecular formula C8H17Cl2FN2 and a molecular weight of 231.14 g/mol. IUPAC name: N-[[(3R,4S)-4-fluoropyrrolidin-3-yl]methyl]cyclopropanamine;dihydrochloride. InChIKey: WCCHCPXGHNZVNV-QGTMZHJHSA-N.
| Molecular formula | C8H17Cl2FN2 |
|---|---|
| Molecular weight | 231.14 g/mol |
| IUPAC name | N-[[(3R,4S)-4-fluoropyrrolidin-3-yl]methyl]cyclopropanamine;dihydrochloride |
| InChIKey | WCCHCPXGHNZVNV-QGTMZHJHSA-N |
| SMILES | C1CC1NC[C@H]2CNC[C@H]2F.Cl.Cl |
Computed by PubChem (NCBI)