Products 21061-92-7
CAS 21061-92-7 appears in our catalog under these names: 6α–Hydroxylycopodine, 6α-Hydroxylycopodine, 6α-Hydroxylycopodine. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, Get quote.
(1R,2R,10S,12S,13R,15R)-12-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-one (CAS 21061-92-7) is a chemical compound with the molecular formula C16H25NO2 and a molecular weight of 263.37 g/mol. IUPAC name: (1R,2R,10S,12S,13R,15R)-12-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-one. InChIKey: AWIZLLPREQJRKH-GXVXIZHISA-N.
| Molecular formula | C16H25NO2 |
|---|---|
| Molecular weight | 263.37 g/mol |
| IUPAC name | (1R,2R,10S,12S,13R,15R)-12-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-one |
| InChIKey | AWIZLLPREQJRKH-GXVXIZHISA-N |
| SMILES | C[C@@H]1C[C@@H]2[C@H]3CCCN4[C@@]3(C1)[C@H](CCC4)C(=O)[C@H]2O |
Computed by PubChem (NCBI)