CAS 210690-26-9 appears in our catalog under these names: Fenspiride N-Oxide, Fenspiride N-Oxide, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 250mg, 25mg.
8-oxido-8-(2-phenylethyl)-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one (CAS 210690-26-9) is a chemical compound with the molecular formula C15H20N2O3 and a molecular weight of 276.33 g/mol. IUPAC name: 8-oxido-8-(2-phenylethyl)-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one. InChIKey: PEYJGEWJSVTMEN-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O3 |
|---|---|
| Molecular weight | 276.33 g/mol |
| IUPAC name | 8-oxido-8-(2-phenylethyl)-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one |
| InChIKey | PEYJGEWJSVTMEN-UHFFFAOYSA-N |
| SMILES | C1C[N+](CCC12CNC(=O)O2)(CCC3=CC=CC=C3)[O-] |
Computed by PubChem (NCBI)