CAS 210776-65-1 is the registry number for 3,4-Dichloromethylphenidate, threo, racemic. Offered by: Biosynth. Available pack sizes: 100mg, 50mg.
Methyl (2R)-2-(3,4-dichlorophenyl)-2-[(2R)-piperidin-2-yl]acetate (CAS 210776-65-1) is a chemical compound with the molecular formula C14H17Cl2NO2 and a molecular weight of 302.2 g/mol. IUPAC name: methyl (2R)-2-(3,4-dichlorophenyl)-2-[(2R)-piperidin-2-yl]acetate. InChIKey: JUKMAYKVHWKRKY-CHWSQXEVSA-N.
| Molecular formula | C14H17Cl2NO2 |
|---|---|
| Molecular weight | 302.2 g/mol |
| IUPAC name | methyl (2R)-2-(3,4-dichlorophenyl)-2-[(2R)-piperidin-2-yl]acetate |
| InChIKey | JUKMAYKVHWKRKY-CHWSQXEVSA-N |
| SMILES | COC(=O)[C@@H]([C@H]1CCCCN1)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)