Products 259729-84-5
CAS 259729-84-5 is the registry number for AC915. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-pyrrolidin-1-ylethyl 2-(3,4-dichlorophenyl)acetate (CAS 259729-84-5) is a chemical compound with the molecular formula C14H17Cl2NO2 and a molecular weight of 302.2 g/mol. IUPAC name: 2-pyrrolidin-1-ylethyl 2-(3,4-dichlorophenyl)acetate. InChIKey: CYVORFBBJKNNDO-UHFFFAOYSA-N.
| Molecular formula | C14H17Cl2NO2 |
|---|---|
| Molecular weight | 302.2 g/mol |
| IUPAC name | 2-pyrrolidin-1-ylethyl 2-(3,4-dichlorophenyl)acetate |
| InChIKey | CYVORFBBJKNNDO-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CCOC(=O)CC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
Benzeneacetic acid, 3,4-dichloro-, 2-(1-pyrrolidinyl)ethyl ester, 2-pyrrolidin-1-ylethyl 2-(3,4-dichlorophenyl)acetate, Lopac-A-3595, Lopac0_000016, orb1701275, 2-(pyrrolidin-1-yl)ethyl 2-(3,4-dichlorophenyl)acetate, 2-(Pyrrolidin-1-yl)ethyl (3,4-dichlorophenyl)acetate, (3,4-Dichloro-phenyl)-acetic acid 2-pyrrolidin-1-yl-ethyl ester