Products 2107765-51-3

CAS 2107765-51-3 is the registry number for Arbidol Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.

Ethyl 7-hydroxy-1,2-dimethylindole-3-carboxylate (CAS 2107765-51-3) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: ethyl 7-hydroxy-1,2-dimethylindole-3-carboxylate. InChIKey: VPLMRTCICSBKPE-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15NO3
Molecular weight233.26 g/mol
IUPAC nameethyl 7-hydroxy-1,2-dimethylindole-3-carboxylate
InChIKeyVPLMRTCICSBKPE-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(N(C2=C1C=CC=C2O)C)C

Computed by PubChem (NCBI)