CAS 2108550-91-8 is the registry number for 3-(8-Methyl-1,2,3,4-tetrahydro-5h-pyrido[4,3-b]indol-5-yl)propanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(8-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-5-yl)propanoic acid;hydrochloride (CAS 2108550-91-8) is a chemical compound with the molecular formula C15H19ClN2O2 and a molecular weight of 294.77 g/mol. IUPAC name: 3-(8-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-5-yl)propanoic acid;hydrochloride. InChIKey: HQJIMDIIQDSGBN-UHFFFAOYSA-N.
| Molecular formula | C15H19ClN2O2 |
|---|---|
| Molecular weight | 294.77 g/mol |
| IUPAC name | 3-(8-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-5-yl)propanoic acid;hydrochloride |
| InChIKey | HQJIMDIIQDSGBN-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(C3=C2CNCC3)CCC(=O)O.Cl |
Computed by PubChem (NCBI)