CAS 2060046-17-3 is the registry number for tert-Butyl 5'-Chloro-1',2'-dihydrospiro(azetidine-3,3'-indole)-1-carboxylate. Offered by: TRC. Available pack sizes: 250mg.
Tert-butyl 5-chlorospiro[1,2-dihydroindole-3,3'-azetidine]-1'-carboxylate (CAS 2060046-17-3) is a chemical compound with the molecular formula C15H19ClN2O2 and a molecular weight of 294.77 g/mol. IUPAC name: tert-butyl 5-chlorospiro[1,2-dihydroindole-3,3'-azetidine]-1'-carboxylate. InChIKey: YVAICFCIHOLYTO-UHFFFAOYSA-N.
| Molecular formula | C15H19ClN2O2 |
|---|---|
| Molecular weight | 294.77 g/mol |
| IUPAC name | tert-butyl 5-chlorospiro[1,2-dihydroindole-3,3'-azetidine]-1'-carboxylate |
| InChIKey | YVAICFCIHOLYTO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CNC3=C2C=C(C=C3)Cl |
Computed by PubChem (NCBI)