CAS 66512-39-8 appears in our catalog under these names: (R)-Etomidate EP Impurity C HCl, Etomidate EP Impurity C（HCl）. Offered by: Chemat Brand. Available pack sizes: on request.
Propan-2-yl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate;hydrochloride (CAS 66512-39-8) is a chemical compound with the molecular formula C15H19ClN2O2 and a molecular weight of 294.77 g/mol. IUPAC name: propan-2-yl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate;hydrochloride. InChIKey: GLHYKXLBGHQXMN-UTONKHPSSA-N.
| Molecular formula | C15H19ClN2O2 |
|---|---|
| Molecular weight | 294.77 g/mol |
| IUPAC name | propan-2-yl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate;hydrochloride |
| InChIKey | GLHYKXLBGHQXMN-UTONKHPSSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)N2C=NC=C2C(=O)OC(C)C.Cl |
Computed by PubChem (NCBI)