Products 210883-77-5
CAS 210883-77-5 is the registry number for (R)-1-Benzylazetidine-2-carboxylic acid, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2R)-1-benzylazetidine-2-carboxylic acid (CAS 210883-77-5) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: (2R)-1-benzylazetidine-2-carboxylic acid. InChIKey: WHUOCTPLGJOLFL-SNVBAGLBSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | (2R)-1-benzylazetidine-2-carboxylic acid |
| InChIKey | WHUOCTPLGJOLFL-SNVBAGLBSA-N |
| SMILES | C1CN([C@H]1C(=O)O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
(R)-1-Benzylazetidine-2-carboxylic acid