Products 210961-92-5
CAS 210961-92-5 appears in our catalog under these names: 4-(1-Piperidinylcarbonyl)benzoic acid, 96%, 4-(Piperidine-1-carbonyl)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-(piperidine-1-carbonyl)benzoic acid (CAS 210961-92-5) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: 4-(piperidine-1-carbonyl)benzoic acid. InChIKey: CCQPDDNFTHQPCX-UHFFFAOYSA-N.
| Molecular formula | C13H15NO3 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | 4-(piperidine-1-carbonyl)benzoic acid |
| InChIKey | CCQPDDNFTHQPCX-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)