Products 2109871-68-1

CAS 2109871-68-1 is the registry number for Methyl 6-cyclobutylpyridine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 6-cyclobutylpyridine-3-carboxylate (CAS 2109871-68-1) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: methyl 6-cyclobutylpyridine-3-carboxylate. InChIKey: UTAYEUMKUJOTJL-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13NO2
Molecular weight191.23 g/mol
IUPAC namemethyl 6-cyclobutylpyridine-3-carboxylate
InChIKeyUTAYEUMKUJOTJL-UHFFFAOYSA-N
SMILESCOC(=O)C1=CN=C(C=C1)C2CCC2

Computed by PubChem (NCBI)