Products 2110693-28-0

CAS 2110693-28-0 is the registry number for O7-tert-butyl O2-methyl 7-azaspiro[2.6]nonane-2,7-dicarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.

Structural formula: {0} (CAS {1})

7-O-tert-butyl 2-O-methyl 7-azaspiro[2.6]nonane-2,7-dicarboxylate (CAS 2110693-28-0) is a chemical compound with the molecular formula C15H25NO4 and a molecular weight of 283.36 g/mol. IUPAC name: 7-O-tert-butyl 2-O-methyl 7-azaspiro[2.6]nonane-2,7-dicarboxylate. InChIKey: LRMMEELCLMERMP-UHFFFAOYSA-N.

Identity
Molecular formulaC15H25NO4
Molecular weight283.36 g/mol
IUPAC name7-O-tert-butyl 2-O-methyl 7-azaspiro[2.6]nonane-2,7-dicarboxylate
InChIKeyLRMMEELCLMERMP-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCC2(CC1)CC2C(=O)OC

Computed by PubChem (NCBI)