Products 2111067-88-8
CAS 2111067-88-8 appears in our catalog under these names: 5-(3,4-Difluorophenyl)-3-methyl-1h-pyrrole-2-carboxylic acid, 95%, 5–(3，4–Difluorophenyl)–3–methyl–1H–pyrrole–2–carboxylic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 100mg, 250mg.
5-(3,4-difluorophenyl)-3-methyl-1H-pyrrole-2-carboxylic acid (CAS 2111067-88-8) is a chemical compound with the molecular formula C12H9F2NO2 and a molecular weight of 237.20 g/mol. IUPAC name: 5-(3,4-difluorophenyl)-3-methyl-1H-pyrrole-2-carboxylic acid. InChIKey: MUTNRANMULZGJX-UHFFFAOYSA-N.
| Molecular formula | C12H9F2NO2 |
|---|---|
| Molecular weight | 237.20 g/mol |
| IUPAC name | 5-(3,4-difluorophenyl)-3-methyl-1H-pyrrole-2-carboxylic acid |
| InChIKey | MUTNRANMULZGJX-UHFFFAOYSA-N |
| SMILES | CC1=C(NC(=C1)C2=CC(=C(C=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)