Products 623572-48-5
CAS 623572-48-5 is the registry number for Ethyl 2-cyano-3-(3,4-difluorophenyl)prop-2-enoate. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
Ethyl (Z)-2-cyano-3-(3,4-difluorophenyl)prop-2-enoate (CAS 623572-48-5) is a chemical compound with the molecular formula C12H9F2NO2 and a molecular weight of 237.20 g/mol. IUPAC name: ethyl (Z)-2-cyano-3-(3,4-difluorophenyl)prop-2-enoate. InChIKey: DLTJIBLUUMKTIU-UITAMQMPSA-N.
| Molecular formula | C12H9F2NO2 |
|---|---|
| Molecular weight | 237.20 g/mol |
| IUPAC name | ethyl (Z)-2-cyano-3-(3,4-difluorophenyl)prop-2-enoate |
| InChIKey | DLTJIBLUUMKTIU-UITAMQMPSA-N |
| SMILES | CCOC(=O)/C(=C\C1=CC(=C(C=C1)F)F)/C#N |
Computed by PubChem (NCBI)