CAS 2111835-02-8 appears in our catalog under these names: 5-Methoxy-N-methyl-N-isopropyl Tryptamine N-Oxide, 5-MeO-MiPT N-oxide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-N-methylpropan-2-amine oxide (CAS 2111835-02-8) is a chemical compound with the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. IUPAC name: N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-N-methylpropan-2-amine oxide. InChIKey: YGRMKSKIEFUENJ-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O2 |
|---|---|
| Molecular weight | 262.35 g/mol |
| IUPAC name | N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-N-methylpropan-2-amine oxide |
| InChIKey | YGRMKSKIEFUENJ-UHFFFAOYSA-N |
| SMILES | CC(C)[N+](C)(CCC1=CNC2=C1C=C(C=C2)OC)[O-] |
Computed by PubChem (NCBI)