CAS 2111909-84-1 is the registry number for 4-(1,2,2,4-Tetramethyl-1,2,3,4-tetrahydroquinolin-6-yl)but-3-en-2-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
(E)-4-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)but-3-en-2-one (CAS 2111909-84-1) is a chemical compound with the molecular formula C17H23NO and a molecular weight of 257.37 g/mol. IUPAC name: (E)-4-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)but-3-en-2-one. InChIKey: RLFVJEAHFAKETJ-VOTSOKGWSA-N.
| Molecular formula | C17H23NO |
|---|---|
| Molecular weight | 257.37 g/mol |
| IUPAC name | (E)-4-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)but-3-en-2-one |
| InChIKey | RLFVJEAHFAKETJ-VOTSOKGWSA-N |
| SMILES | CC1CC(N(C2=C1C=C(C=C2)/C=C/C(=O)C)C)(C)C |
Computed by PubChem (NCBI)