Products 1531-25-5
CAS 1531-25-5 appears in our catalog under these names: 3-METHOXYMORPHINAN HCL, 3-Methoxymorphinan, (9R,10S)-4-Methoxy-17-azatetracyclo(7.5.3.01,10.02,7)heptadeca-2(7),3,5-triene. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 50mg, 5mg, 10mg, 25mg.
(1R,9R,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (CAS 1531-25-5) is a chemical compound with the molecular formula C17H23NO and a molecular weight of 257.37 g/mol. IUPAC name: (1R,9R,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene. InChIKey: ILNSWVUXAPSPEH-USXIJHARSA-N.
| Molecular formula | C17H23NO |
|---|---|
| Molecular weight | 257.37 g/mol |
| IUPAC name | (1R,9R,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| InChIKey | ILNSWVUXAPSPEH-USXIJHARSA-N |
| SMILES | COC1=CC2=C(C[C@@H]3[C@H]4[C@@]2(CCCC4)CCN3)C=C1 |
Computed by PubChem (NCBI)