CAS 2112-22-3 appears in our catalog under these names: 2,3–Dichloro–6–nitrobenzonitrile, 2,3-Dichloro-6-nitrobenzonitrile, 2,3-Dichloro-6-nitrobenzonitrile 97%, Benzonitrile, 2,3-dichloro-6-nitro-, 97%, 97%, 2,3-Dichloro-6-nitrobenzonitrile, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 250g, 5g, 10g, 1g.
2,3-dichloro-6-nitrobenzonitrile (CAS 2112-22-3) is a chemical compound with the molecular formula C7H2Cl2N2O2 and a molecular weight of 217.01 g/mol. IUPAC name: 2,3-dichloro-6-nitrobenzonitrile. InChIKey: RDFDRMZYAXQLRT-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2N2O2 |
|---|---|
| Molecular weight | 217.01 g/mol |
| IUPAC name | 2,3-dichloro-6-nitrobenzonitrile |
| InChIKey | RDFDRMZYAXQLRT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])C#N)Cl)Cl |
Computed by PubChem (NCBI)