CAS 861545-83-7 appears in our catalog under these names: 4,6–Dichloro–5–cyanopicolinic acid, 4,6-dichloro-5-cyanopyridine-2-carboxylic acid. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 1g, 250mg.
4,6-dichloro-5-cyanopyridine-2-carboxylic acid (CAS 861545-83-7) is a chemical compound with the molecular formula C7H2Cl2N2O2 and a molecular weight of 217.01 g/mol. IUPAC name: 4,6-dichloro-5-cyanopyridine-2-carboxylic acid. InChIKey: NOLRVNOZBGZFCN-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2N2O2 |
|---|---|
| Molecular weight | 217.01 g/mol |
| IUPAC name | 4,6-dichloro-5-cyanopyridine-2-carboxylic acid |
| InChIKey | NOLRVNOZBGZFCN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1C(=O)O)Cl)C#N)Cl |
Computed by PubChem (NCBI)