CAS 2112153-48-5 is the registry number for METHYL 5-(3,4-DIFLUORO-2-METHOXYPHENYL)-1H-PYRAZOLE-3-CARBOXYLATE, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 3-(3,4-difluoro-2-methoxyphenyl)-1H-pyrazole-5-carboxylate (CAS 2112153-48-5) is a chemical compound with the molecular formula C12H10F2N2O3 and a molecular weight of 268.22 g/mol. IUPAC name: methyl 3-(3,4-difluoro-2-methoxyphenyl)-1H-pyrazole-5-carboxylate. InChIKey: SHZXKYKOTHBEBY-UHFFFAOYSA-N.
| Molecular formula | C12H10F2N2O3 |
|---|---|
| Molecular weight | 268.22 g/mol |
| IUPAC name | methyl 3-(3,4-difluoro-2-methoxyphenyl)-1H-pyrazole-5-carboxylate |
| InChIKey | SHZXKYKOTHBEBY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1F)F)C2=NNC(=C2)C(=O)OC |
Computed by PubChem (NCBI)