CAS 21129-82-8 appears in our catalog under these names: 2,4-Dioxo-1,3-diazaspiro(4.5)decane-8-carboxylic acid, 95%, 2,4-Dioxo-1,3-diazaspiro(4.5)decane-8-carboxylic acid, 2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxylic acid, >97%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxylic acid (CAS 21129-82-8) is a chemical compound with the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. IUPAC name: 2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxylic acid. InChIKey: GYCQWMQONISFGK-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxylic acid |
| InChIKey | GYCQWMQONISFGK-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1C(=O)O)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)