CAS 211363-27-8 is the registry number for 4-Chloro-2,3-dimethyl-6-nitrophenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-chloro-2,3-dimethyl-6-nitrophenol (CAS 211363-27-8) is a chemical compound with the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. IUPAC name: 4-chloro-2,3-dimethyl-6-nitrophenol. InChIKey: CFRHQFGPONDFPG-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 4-chloro-2,3-dimethyl-6-nitrophenol |
| InChIKey | CFRHQFGPONDFPG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1C)O)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)