CAS 2114875-92-0 is the registry number for Ethyl 2,3-dimethyl-1-oxo-1,2-dihydroisoquinoline-7-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2,3-dimethyl-1-oxoisoquinoline-7-carboxylate (CAS 2114875-92-0) is a chemical compound with the molecular formula C14H15NO3 and a molecular weight of 245.27 g/mol. IUPAC name: ethyl 2,3-dimethyl-1-oxoisoquinoline-7-carboxylate. InChIKey: WDBFGAIXIAJGPG-UHFFFAOYSA-N.
| Molecular formula | C14H15NO3 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | ethyl 2,3-dimethyl-1-oxoisoquinoline-7-carboxylate |
| InChIKey | WDBFGAIXIAJGPG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)C=C(N(C2=O)C)C |
Computed by PubChem (NCBI)