CAS 211506-59-1 appears in our catalog under these names: (R)-Chroman-3-amine hydrochloride, 95%, (R)–chroman–3–amine hydrochloride, (R)-Chroman-3-amine hydrochloride, 98%, 98%, (R)-Chroman-3-amine hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 50mg, 500mg.
(3R)-3,4-dihydro-2H-chromen-3-amine;hydrochloride (CAS 211506-59-1) is a chemical compound with the molecular formula C9H12ClNO and a molecular weight of 185.65 g/mol. IUPAC name: (3R)-3,4-dihydro-2H-chromen-3-amine;hydrochloride. InChIKey: NSLATPDKWVAAIL-DDWIOCJRSA-N.
| Molecular formula | C9H12ClNO |
|---|---|
| Molecular weight | 185.65 g/mol |
| IUPAC name | (3R)-3,4-dihydro-2H-chromen-3-amine;hydrochloride |
| InChIKey | NSLATPDKWVAAIL-DDWIOCJRSA-N |
| SMILES | C1[C@H](COC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)