CAS 211693-75-3 is the registry number for 4-Chloro-2,3-difluoro-6-nitroaniline, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-chloro-2,3-difluoro-6-nitroaniline (CAS 211693-75-3) is a chemical compound with the molecular formula C6H3ClF2N2O2 and a molecular weight of 208.55 g/mol. IUPAC name: 4-chloro-2,3-difluoro-6-nitroaniline. InChIKey: MNNHSXLQLJDKAV-UHFFFAOYSA-N.
| Molecular formula | C6H3ClF2N2O2 |
|---|---|
| Molecular weight | 208.55 g/mol |
| IUPAC name | 4-chloro-2,3-difluoro-6-nitroaniline |
| InChIKey | MNNHSXLQLJDKAV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)F)F)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)