CAS 870606-46-5 is the registry number for 6-Chloro-3,4-difluoro-2-nitroaniline, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-3,4-difluoro-2-nitroaniline (CAS 870606-46-5) is a chemical compound with the molecular formula C6H3ClF2N2O2 and a molecular weight of 208.55 g/mol. IUPAC name: 6-chloro-3,4-difluoro-2-nitroaniline. InChIKey: XUJPRQRBMZGTCP-UHFFFAOYSA-N.
| Molecular formula | C6H3ClF2N2O2 |
|---|---|
| Molecular weight | 208.55 g/mol |
| IUPAC name | 6-chloro-3,4-difluoro-2-nitroaniline |
| InChIKey | XUJPRQRBMZGTCP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)N)[N+](=O)[O-])F)F |
Computed by PubChem (NCBI)