Products 2117405-23-7
CAS 2117405-23-7 is the registry number for UR–144 N–pentanoic acid metabolite–d5. Offered by: GLPBio. Available pack sizes: 1mg, 5mg, 500μg.
5-[2,4,5,6,7-pentadeuterio-3-(2,2,3,3-tetramethylcyclopropanecarbonyl)indol-1-yl]pentanoic acid (CAS 2117405-23-7) is a chemical compound with the molecular formula C21H27NO3 and a molecular weight of 346.5 g/mol. IUPAC name: 5-[2,4,5,6,7-pentadeuterio-3-(2,2,3,3-tetramethylcyclopropanecarbonyl)indol-1-yl]pentanoic acid. InChIKey: UUTHIAPDCFFQKQ-FOZLTFMXSA-N.
| Molecular formula | C21H27NO3 |
|---|---|
| Molecular weight | 346.5 g/mol |
| IUPAC name | 5-[2,4,5,6,7-pentadeuterio-3-(2,2,3,3-tetramethylcyclopropanecarbonyl)indol-1-yl]pentanoic acid |
| InChIKey | UUTHIAPDCFFQKQ-FOZLTFMXSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2CCCCC(=O)O)[2H])C(=O)C3C(C3(C)C)(C)C)[2H])[2H] |
Computed by PubChem (NCBI)