CAS 211867-47-9 appears in our catalog under these names: Flumorph, 95%, Flumorph, Flumorph 100 µg/mL in Acetonitrile, Flumorph/ 99.55% (existing batch purity), Flumorph (Standard). Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, TargetMol, Sigma-Aldrich. Available pack sizes: 250mg, 1g, 100mg, 10mg, 25mg, 1ml, 50mg, 200mg.
3-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)-1-morpholin-4-ylprop-2-en-1-one (CAS 211867-47-9) is a chemical compound with the molecular formula C21H22FNO4 and a molecular weight of 371.4 g/mol. IUPAC name: 3-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)-1-morpholin-4-ylprop-2-en-1-one. InChIKey: BKBSMMUEEAWFRX-UHFFFAOYSA-N.
| Molecular formula | C21H22FNO4 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | 3-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)-1-morpholin-4-ylprop-2-en-1-one |
| InChIKey | BKBSMMUEEAWFRX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=CC(=O)N2CCOCC2)C3=CC=C(C=C3)F)OC |
Computed by PubChem (NCBI)